C18H24N2O4S — CID 2946996
ethyl 1-[[4-(2-methoxy-2-oxoethyl)phenyl]carbamothioyl]piperidine-4-carboxylate (PubChem CID 2946996) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is ethyl 1-[[4-(2-methoxy-2-oxoethyl)phenyl]carbamothioyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[4-(2-methoxy-2-oxoethyl)phenyl]carbamothioyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 2946996 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | ethyl 1-[[4-(2-methoxy-2-oxoethyl)phenyl]carbamothioyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=S)Nc2ccc(CC(=O)OC)cc2)CC1 |
| InChI | InChI=1S/C18H24N2O4S/c1-3-24-17(22)14-8-10-20(11-9-14)18(25)19-15-6-4-13(5-7-15)12-16(21)23-2/h4-7,14H,3,8-12H2,1-2H3,(H,19,25) |
| InChIKey | SDYRSIWOVMBTOX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|