C17H20N4O3S — CID 135466781
ethyl 1-[(4-oxo-3H-quinazolin-6-yl)carbamothioyl]piperidine-4-carboxylate (PubChem CID 135466781) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is ethyl 1-[(4-oxo-3H-quinazolin-6-yl)carbamothioyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(4-oxo-3H-quinazolin-6-yl)carbamothioyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 135466781 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | ethyl 1-[(4-oxo-3H-quinazolin-6-yl)carbamothioyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=S)Nc2ccc3nc[nH]c(=O)c3c2)CC1 |
| InChI | InChI=1S/C17H20N4O3S/c1-2-24-16(23)11-5-7-21(8-6-11)17(25)20-12-3-4-14-13(9-12)15(22)19-10-18-14/h3-4,9-11H,2,5-8H2,1H3,(H,20,25)(H,18,19,22) |
| InChIKey | KXMRYRSSFMWETA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|