C16H22N2O2S — CID 7943280
ethyl (3S)-1-[(3-methylphenyl)carbamothioyl]piperidine-3-carboxylate (PubChem CID 7943280) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is ethyl (3S)-1-[(3-methylphenyl)carbamothioyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(3-methylphenyl)carbamothioyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 7943280 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | ethyl (3S)-1-[(3-methylphenyl)carbamothioyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=S)Nc2cccc(C)c2)C1 |
| InChI | InChI=1S/C16H22N2O2S/c1-3-20-15(19)13-7-5-9-18(11-13)16(21)17-14-8-4-6-12(2)10-14/h4,6,8,10,13H,3,5,7,9,11H2,1-2H3,(H,17,21)/t13-/m0/s1 |
| InChIKey | VKMCESKQAGJDOR-ZDUSSCGKSA-N |
| XLogP | 2.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|