C14H19N3O2 — CID 51458679
(3R)-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide (PubChem CID 51458679) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is (3R)-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 51458679 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (3R)-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCC[C@@H](C(N)=O)C2)c1 |
| InChI | InChI=1S/C14H19N3O2/c1-10-4-2-6-12(8-10)16-14(19)17-7-3-5-11(9-17)13(15)18/h2,4,6,8,11H,3,5,7,9H2,1H3,(H2,15,18)(H,16,19)/t11-/m1/s1 |
| InChIKey | PUSSAGYROFRULS-LLVKDONJSA-N |
| XLogP | 1.72 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |