C17H27ClN4O2 — CID 119501337
3-N-[2-(methylamino)ethyl]-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide;hydrochloride (PubChem CID 119501337) has the molecular formula C17H27ClN4O2 and a molecular weight of 354.88 g/mol. Its IUPAC name is 3-N-[2-(methylamino)ethyl]-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide;hydrochloride.
| Compound Name | 3-N-[2-(methylamino)ethyl]-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 119501337 |
| Molecular Formula | C17H27ClN4O2 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3-N-[2-(methylamino)ethyl]-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide;hydrochloride |
| SMILES | CNCCNC(=O)C1CCCN(C(=O)Nc2cccc(C)c2)C1.Cl |
| InChI | InChI=1S/C17H26N4O2.ClH/c1-13-5-3-7-15(11-13)20-17(23)21-10-4-6-14(12-21)16(22)19-9-8-18-2;/h3,5,7,11,14,18H,4,6,8-10,12H2,1-2H3,(H,19,22)(H,20,23);1H |
| InChIKey | NSIYPKDRKFOAKP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|