C26H33N3O2 — CID 55910670
1-N-(3-methylphenyl)-3-N-[(1-phenylcyclopentyl)methyl]piperidine-1,3-dicarboxamide (PubChem CID 55910670) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 1-N-(3-methylphenyl)-3-N-[(1-phenylcyclopentyl)methyl]piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-(3-methylphenyl)-3-N-[(1-phenylcyclopentyl)methyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 55910670 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 1-N-(3-methylphenyl)-3-N-[(1-phenylcyclopentyl)methyl]piperidine-1,3-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCCC(C(=O)NCC3(c4ccccc4)CCCC3)C2)c1 |
| InChI | InChI=1S/C26H33N3O2/c1-20-9-7-13-23(17-20)28-25(31)29-16-8-10-21(18-29)24(30)27-19-26(14-5-6-15-26)22-11-3-2-4-12-22/h2-4,7,9,11-13,17,21H,5-6,8,10,14-16,18-19H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | GEKXFETWOZRQIL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |