C24H29N3O2 — CID 24614563
1-N-phenyl-3-N-[(1-phenylcyclobutyl)methyl]piperidine-1,3-dicarboxamide (PubChem CID 24614563) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 1-N-phenyl-3-N-[(1-phenylcyclobutyl)methyl]piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-phenyl-3-N-[(1-phenylcyclobutyl)methyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 24614563 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 1-N-phenyl-3-N-[(1-phenylcyclobutyl)methyl]piperidine-1,3-dicarboxamide |
| SMILES | O=C(NCC1(c2ccccc2)CCC1)C1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C24H29N3O2/c28-22(25-18-24(14-8-15-24)20-10-3-1-4-11-20)19-9-7-16-27(17-19)23(29)26-21-12-5-2-6-13-21/h1-6,10-13,19H,7-9,14-18H2,(H,25,28)(H,26,29) |
| InChIKey | OABCPPRMDKLAHL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |