C18H21N3O3 — CID 7435298
(3S)-3-N-(furan-2-ylmethyl)-1-N-phenylpiperidine-1,3-dicarboxamide (PubChem CID 7435298) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is (3S)-3-N-(furan-2-ylmethyl)-1-N-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-(furan-2-ylmethyl)-1-N-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 7435298 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (3S)-3-N-(furan-2-ylmethyl)-1-N-phenylpiperidine-1,3-dicarboxamide |
| SMILES | O=C(NCc1ccco1)[C@H]1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C18H21N3O3/c22-17(19-12-16-9-5-11-24-16)14-6-4-10-21(13-14)18(23)20-15-7-2-1-3-8-15/h1-3,5,7-9,11,14H,4,6,10,12-13H2,(H,19,22)(H,20,23)/t14-/m0/s1 |
| InChIKey | NGFXLJJPHQQXFA-AWEZNQCLSA-N |
| XLogP | 2.84 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |