C22H34N4O2 — CID 119620174
3-N-[2-(cycloheptylamino)ethyl]-1-N-phenylpiperidine-1,3-dicarboxamide (PubChem CID 119620174) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 3-N-[2-(cycloheptylamino)ethyl]-1-N-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-[2-(cycloheptylamino)ethyl]-1-N-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 119620174 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 3-N-[2-(cycloheptylamino)ethyl]-1-N-phenylpiperidine-1,3-dicarboxamide |
| SMILES | O=C(NCCNC1CCCCCC1)C1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C22H34N4O2/c27-21(24-15-14-23-19-10-4-1-2-5-11-19)18-9-8-16-26(17-18)22(28)25-20-12-6-3-7-13-20/h3,6-7,12-13,18-19,23H,1-2,4-5,8-11,14-17H2,(H,24,27)(H,25,28) |
| InChIKey | HXIRVZCKHVNXRH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|