C25H31N5O3 — CID 95116250
(3S)-3-N-cyclopentyl-1-N-[4-(phenylcarbamoylamino)phenyl]piperidine-1,3-dicarboxamide (PubChem CID 95116250) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is (3S)-3-N-cyclopentyl-1-N-[4-(phenylcarbamoylamino)phenyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-cyclopentyl-1-N-[4-(phenylcarbamoylamino)phenyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 95116250 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | (3S)-3-N-cyclopentyl-1-N-[4-(phenylcarbamoylamino)phenyl]piperidine-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(NC(=O)N2CCC[C@H](C(=O)NC3CCCC3)C2)cc1 |
| InChI | InChI=1S/C25H31N5O3/c31-23(26-19-10-4-5-11-19)18-7-6-16-30(17-18)25(33)29-22-14-12-21(13-15-22)28-24(32)27-20-8-2-1-3-9-20/h1-3,8-9,12-15,18-19H,4-7,10-11,16-17H2,(H,26,31)(H,29,33)(H2,27,28,32)/t18-/m0/s1 |
| InChIKey | QJCJDJRILANXDJ-SFHVURJKSA-N |
| XLogP | 4.63 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |