C21H30N4O2 — CID 55561482
3-N-(1-cyclopropylpiperidin-4-yl)-1-N-phenylpiperidine-1,3-dicarboxamide (PubChem CID 55561482) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 3-N-(1-cyclopropylpiperidin-4-yl)-1-N-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-(1-cyclopropylpiperidin-4-yl)-1-N-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 55561482 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 3-N-(1-cyclopropylpiperidin-4-yl)-1-N-phenylpiperidine-1,3-dicarboxamide |
| SMILES | O=C(NC1CCN(C2CC2)CC1)C1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C21H30N4O2/c26-20(22-18-10-13-24(14-11-18)19-8-9-19)16-5-4-12-25(15-16)21(27)23-17-6-2-1-3-7-17/h1-3,6-7,16,18-19H,4-5,8-15H2,(H,22,26)(H,23,27) |
| InChIKey | LZLOXKFJAPUKNI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |