C19H20ClN3O2 — CID 8865149
(3S)-3-N-(2-chlorophenyl)-1-N-phenylpiperidine-1,3-dicarboxamide (PubChem CID 8865149) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is (3S)-3-N-(2-chlorophenyl)-1-N-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-(2-chlorophenyl)-1-N-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 8865149 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (3S)-3-N-(2-chlorophenyl)-1-N-phenylpiperidine-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccccc1Cl)[C@H]1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C19H20ClN3O2/c20-16-10-4-5-11-17(16)22-18(24)14-7-6-12-23(13-14)19(25)21-15-8-2-1-3-9-15/h1-5,8-11,14H,6-7,12-13H2,(H,21,25)(H,22,24)/t14-/m0/s1 |
| InChIKey | PXLLSRBUMWPBHO-AWEZNQCLSA-N |
| XLogP | 4.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |