C13H16ClN3O2 — CID 7366630
(3S)-1-N-(2-chlorophenyl)piperidine-1,3-dicarboxamide (PubChem CID 7366630) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is (3S)-1-N-(2-chlorophenyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N-(2-chlorophenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 7366630 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (3S)-1-N-(2-chlorophenyl)piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)[C@H]1CCCN(C(=O)Nc2ccccc2Cl)C1 |
| InChI | InChI=1S/C13H16ClN3O2/c14-10-5-1-2-6-11(10)16-13(19)17-7-3-4-9(8-17)12(15)18/h1-2,5-6,9H,3-4,7-8H2,(H2,15,18)(H,16,19)/t9-/m0/s1 |
| InChIKey | CCBYJKRCJOBINK-VIFPVBQESA-N |
| XLogP | 2.07 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |