C13H17ClN4O2 — CID 129359179
(3S)-1-N-(3-chloro-2-methyl-4-pyridinyl)piperidine-1,3-dicarboxamide (PubChem CID 129359179) has the molecular formula C13H17ClN4O2 and a molecular weight of 296.76 g/mol. Its IUPAC name is (3S)-1-N-(3-chloro-2-methyl-4-pyridinyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N-(3-chloro-2-methyl-4-pyridinyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 129359179 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (3S)-1-N-(3-chloro-2-methyl-4-pyridinyl)piperidine-1,3-dicarboxamide |
| SMILES | Cc1nccc(NC(=O)N2CCC[C@H](C(N)=O)C2)c1Cl |
| InChI | InChI=1S/C13H17ClN4O2/c1-8-11(14)10(4-5-16-8)17-13(20)18-6-2-3-9(7-18)12(15)19/h4-5,9H,2-3,6-7H2,1H3,(H2,15,19)(H,16,17,20)/t9-/m0/s1 |
| InChIKey | MXGOLSQKTGZCPZ-VIFPVBQESA-N |
| XLogP | 1.77 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |