C15H21N3O3 — CID 172675108
(3S)-1-N-[2-(methoxymethyl)phenyl]piperidine-1,3-dicarboxamide (PubChem CID 172675108) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is (3S)-1-N-[2-(methoxymethyl)phenyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N-[2-(methoxymethyl)phenyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 172675108 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (3S)-1-N-[2-(methoxymethyl)phenyl]piperidine-1,3-dicarboxamide |
| SMILES | COCc1ccccc1NC(=O)N1CCC[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C15H21N3O3/c1-21-10-12-5-2-3-7-13(12)17-15(20)18-8-4-6-11(9-18)14(16)19/h2-3,5,7,11H,4,6,8-10H2,1H3,(H2,16,19)(H,17,20)/t11-/m0/s1 |
| InChIKey | GUBBGFXTNMOAAR-NSHDSACASA-N |
| XLogP | 1.56 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |