C16H21N3O2S — CID 172908594
(3S)-1-N-(2-cyclopropylsulfanylphenyl)piperidine-1,3-dicarboxamide (PubChem CID 172908594) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is (3S)-1-N-(2-cyclopropylsulfanylphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N-(2-cyclopropylsulfanylphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 172908594 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (3S)-1-N-(2-cyclopropylsulfanylphenyl)piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)[C@H]1CCCN(C(=O)Nc2ccccc2SC2CC2)C1 |
| InChI | InChI=1S/C16H21N3O2S/c17-15(20)11-4-3-9-19(10-11)16(21)18-13-5-1-2-6-14(13)22-12-7-8-12/h1-2,5-6,11-12H,3-4,7-10H2,(H2,17,20)(H,18,21)/t11-/m0/s1 |
| InChIKey | NRHXRDKTQQQCFH-NSHDSACASA-N |
| XLogP | 2.67 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |