C17H22N2O3S — CID 122075791
1-[(2-cyclopentylsulfanylphenyl)carbamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 122075791) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-[(2-cyclopentylsulfanylphenyl)carbamoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[(2-cyclopentylsulfanylphenyl)carbamoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122075791 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-[(2-cyclopentylsulfanylphenyl)carbamoyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)Nc2ccccc2SC2CCCC2)C1 |
| InChI | InChI=1S/C17H22N2O3S/c20-16(21)12-9-10-19(11-12)17(22)18-14-7-3-4-8-15(14)23-13-5-1-2-6-13/h3-4,7-8,12-13H,1-2,5-6,9-11H2,(H,18,22)(H,20,21) |
| InChIKey | JLBWKGIVXPQZNP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |