C22H26N2O2S2 — CID 32559552
N-(2-cyclopentylsulfanylphenyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 32559552) has the molecular formula C22H26N2O2S2 and a molecular weight of 414.60 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylphenyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(2-cyclopentylsulfanylphenyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 32559552 |
| Molecular Formula | C22H26N2O2S2 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-(2-cyclopentylsulfanylphenyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1SC1CCCC1)C1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C22H26N2O2S2/c25-21(16-11-13-24(14-12-16)22(26)20-10-5-15-27-20)23-18-8-3-4-9-19(18)28-17-6-1-2-7-17/h3-5,8-10,15-17H,1-2,6-7,11-14H2,(H,23,25) |
| InChIKey | NFIDYMXMVQQZJU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |