C22H28N4O2S — CID 46820339
N-[2-(4-methylpiperazin-1-yl)phenyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 46820339) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)phenyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)phenyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46820339 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)phenyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | CN1CCN(c2ccccc2NC(=O)C2CCN(C(=O)c3cccs3)CC2)CC1 |
| InChI | InChI=1S/C22H28N4O2S/c1-24-12-14-25(15-13-24)19-6-3-2-5-18(19)23-21(27)17-8-10-26(11-9-17)22(28)20-7-4-16-29-20/h2-7,16-17H,8-15H2,1H3,(H,23,27) |
| InChIKey | GQNXZZVOJZVGJV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |