C24H27BrN2O2S — CID 32559647
1-(4-bromobenzoyl)-N-(2-cyclopentylsulfanylphenyl)piperidine-4-carboxamide (PubChem CID 32559647) has the molecular formula C24H27BrN2O2S and a molecular weight of 487.46 g/mol. Its IUPAC name is 1-(4-bromobenzoyl)-N-(2-cyclopentylsulfanylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-bromobenzoyl)-N-(2-cyclopentylsulfanylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 32559647 |
| Molecular Formula | C24H27BrN2O2S |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 1-(4-bromobenzoyl)-N-(2-cyclopentylsulfanylphenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1SC1CCCC1)C1CCN(C(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C24H27BrN2O2S/c25-19-11-9-18(10-12-19)24(29)27-15-13-17(14-16-27)23(28)26-21-7-3-4-8-22(21)30-20-5-1-2-6-20/h3-4,7-12,17,20H,1-2,5-6,13-16H2,(H,26,28) |
| InChIKey | XMSLQXYDHKCDOB-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |