C21H23BrClN3O2 — CID 55762993
1-(4-bromobenzoyl)-N-[3-chloro-2-(dimethylamino)phenyl]piperidine-4-carboxamide (PubChem CID 55762993) has the molecular formula C21H23BrClN3O2 and a molecular weight of 464.79 g/mol. Its IUPAC name is 1-(4-bromobenzoyl)-N-[3-chloro-2-(dimethylamino)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-bromobenzoyl)-N-[3-chloro-2-(dimethylamino)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55762993 |
| Molecular Formula | C21H23BrClN3O2 |
| Molecular Weight | 464.79 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 1-(4-bromobenzoyl)-N-[3-chloro-2-(dimethylamino)phenyl]piperidine-4-carboxamide |
| SMILES | CN(C)c1c(Cl)cccc1NC(=O)C1CCN(C(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C21H23BrClN3O2/c1-25(2)19-17(23)4-3-5-18(19)24-20(27)14-10-12-26(13-11-14)21(28)15-6-8-16(22)9-7-15/h3-9,14H,10-13H2,1-2H3,(H,24,27) |
| InChIKey | KJRNWCJGRFMYOW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.79 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |