About 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide
1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide (PubChem CID 9180450) has the molecular formula C15H20BrN3O2
and a molecular weight of 354.25 g/mol. Its IUPAC name is 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide.
Molecular Properties
| Compound Name | 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide |
| PubChem CID | 9180450 |
| Molecular Formula | C15H20BrN3O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide |
| SMILES | CN(C)NC(=O)C1CCN(C(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C15H20BrN3O2/c1-18(2)17-14(20)11-7-9-19(10-8-11)15(21)12-3-5-13(16)6-4-12/h3-6,11H,7-10H2,1-2H3,(H,17,20) |
| InChIKey | NKTYLRUWXKIBMP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide?
The IUPAC name of 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide (CID 9180450) is 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide.
What is the SMILES notation for 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide?
The canonical SMILES for 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide is CN(C)NC(=O)C1CCN(C(=O)c2ccc(Br)cc2)CC1.
What is the InChIKey of 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide?
The InChIKey is NKTYLRUWXKIBMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrN3O2/c1-18(2)17-14(20)11-7-9-19(10-8-11)15(21)12-3-5-13(16)6-4-12/h3-6,11H,7-10H2,1-2H3,(H,17,20).
What are the key properties of 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide?
1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide has a molecular weight of 354.25 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide is sourced from PubChem (CID 9180450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).