C15H20BrN3O2 — CID 9180450
1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide (PubChem CID 9180450) has the molecular formula C15H20BrN3O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide.
| Compound Name | 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 9180450 |
| Molecular Formula | C15H20BrN3O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 1-(4-bromobenzoyl)-N',N'-dimethylpiperidine-4-carbohydrazide |
| SMILES | CN(C)NC(=O)C1CCN(C(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C15H20BrN3O2/c1-18(2)17-14(20)11-7-9-19(10-8-11)15(21)12-3-5-13(16)6-4-12/h3-6,11H,7-10H2,1-2H3,(H,17,20) |
| InChIKey | NKTYLRUWXKIBMP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|