C22H25BrN2O5 — CID 26701571
1-(4-bromobenzoyl)-N-(3,4,5-trimethoxyphenyl)piperidine-4-carboxamide (PubChem CID 26701571) has the molecular formula C22H25BrN2O5 and a molecular weight of 477.36 g/mol. Its IUPAC name is 1-(4-bromobenzoyl)-N-(3,4,5-trimethoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-bromobenzoyl)-N-(3,4,5-trimethoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26701571 |
| Molecular Formula | C22H25BrN2O5 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 1-(4-bromobenzoyl)-N-(3,4,5-trimethoxyphenyl)piperidine-4-carboxamide |
| SMILES | COc1cc(NC(=O)C2CCN(C(=O)c3ccc(Br)cc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H25BrN2O5/c1-28-18-12-17(13-19(29-2)20(18)30-3)24-21(26)14-8-10-25(11-9-14)22(27)15-4-6-16(23)7-5-15/h4-7,12-14H,8-11H2,1-3H3,(H,24,26) |
| InChIKey | IXFFJOHJMIVURH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |