C23H27N3O6 — CID 126029026
N-(4-carbamoylphenyl)-1-(3,4,5-trimethoxybenzoyl)piperidine-4-carboxamide (PubChem CID 126029026) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-1-(3,4,5-trimethoxybenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(4-carbamoylphenyl)-1-(3,4,5-trimethoxybenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126029026 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N-(4-carbamoylphenyl)-1-(3,4,5-trimethoxybenzoyl)piperidine-4-carboxamide |
| SMILES | COc1cc(C(=O)N2CCC(C(=O)Nc3ccc(C(N)=O)cc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C23H27N3O6/c1-30-18-12-16(13-19(31-2)20(18)32-3)23(29)26-10-8-15(9-11-26)22(28)25-17-6-4-14(5-7-17)21(24)27/h4-7,12-13,15H,8-11H2,1-3H3,(H2,24,27)(H,25,28) |
| InChIKey | ODJXICMSIDISHI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |