C22H24F2N2O5 — CID 126094414
N-(2,6-difluorophenyl)-1-(3,4,5-trimethoxybenzoyl)piperidine-4-carboxamide (PubChem CID 126094414) has the molecular formula C22H24F2N2O5 and a molecular weight of 434.44 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-1-(3,4,5-trimethoxybenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-1-(3,4,5-trimethoxybenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126094414 |
| Molecular Formula | C22H24F2N2O5 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | N-(2,6-difluorophenyl)-1-(3,4,5-trimethoxybenzoyl)piperidine-4-carboxamide |
| SMILES | COc1cc(C(=O)N2CCC(C(=O)Nc3c(F)cccc3F)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H24F2N2O5/c1-29-17-11-14(12-18(30-2)20(17)31-3)22(28)26-9-7-13(8-10-26)21(27)25-19-15(23)5-4-6-16(19)24/h4-6,11-13H,7-10H2,1-3H3,(H,25,27) |
| InChIKey | VYEVFCUPYSWOGV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |