C19H15F5N2O2 — CID 113008965
N-(2,6-difluorophenyl)-1-(2,3,4-trifluorobenzoyl)piperidine-4-carboxamide (PubChem CID 113008965) has the molecular formula C19H15F5N2O2 and a molecular weight of 398.33 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-1-(2,3,4-trifluorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-1-(2,3,4-trifluorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113008965 |
| Molecular Formula | C19H15F5N2O2 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-(2,6-difluorophenyl)-1-(2,3,4-trifluorobenzoyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)C1CCN(C(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C19H15F5N2O2/c20-12-5-4-11(15(23)16(12)24)19(28)26-8-6-10(7-9-26)18(27)25-17-13(21)2-1-3-14(17)22/h1-5,10H,6-9H2,(H,25,27) |
| InChIKey | PMBNYJFGVYSRAU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|