C18H23F3N2O — CID 110667097
[4-(azepan-1-yl)piperidin-1-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 110667097) has the molecular formula C18H23F3N2O and a molecular weight of 340.39 g/mol. Its IUPAC name is [4-(azepan-1-yl)piperidin-1-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [4-(azepan-1-yl)piperidin-1-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 110667097 |
| Molecular Formula | C18H23F3N2O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | [4-(azepan-1-yl)piperidin-1-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1F)N1CCC(N2CCCCCC2)CC1 |
| InChI | InChI=1S/C18H23F3N2O/c19-15-6-5-14(16(20)17(15)21)18(24)23-11-7-13(8-12-23)22-9-3-1-2-4-10-22/h5-6,13H,1-4,7-12H2 |
| InChIKey | KQEBILSSSXYFAW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|