C11H10F3NO3 — CID 106671138
(3,4-dihydroxypyrrolidin-1-yl)-(2,3,4-trifluorophenyl)methanone (PubChem CID 106671138) has the molecular formula C11H10F3NO3 and a molecular weight of 261.20 g/mol. Its IUPAC name is (3,4-dihydroxypyrrolidin-1-yl)-(2,3,4-trifluorophenyl)methanone.
| Compound Name | (3,4-dihydroxypyrrolidin-1-yl)-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 106671138 |
| Molecular Formula | C11H10F3NO3 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (3,4-dihydroxypyrrolidin-1-yl)-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1F)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C11H10F3NO3/c12-6-2-1-5(9(13)10(6)14)11(18)15-3-7(16)8(17)4-15/h1-2,7-8,16-17H,3-4H2 |
| InChIKey | MZKOWRLRDNZZSU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|