C13H13F3N2OS — CID 79749646
1-(2,3,4-trifluorobenzoyl)piperidine-3-carbothioamide (PubChem CID 79749646) has the molecular formula C13H13F3N2OS and a molecular weight of 302.32 g/mol. Its IUPAC name is 1-(2,3,4-trifluorobenzoyl)piperidine-3-carbothioamide.
| Compound Name | 1-(2,3,4-trifluorobenzoyl)piperidine-3-carbothioamide |
|---|---|
| PubChem CID | 79749646 |
| Molecular Formula | C13H13F3N2OS |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1-(2,3,4-trifluorobenzoyl)piperidine-3-carbothioamide |
| SMILES | NC(=S)C1CCCN(C(=O)c2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C13H13F3N2OS/c14-9-4-3-8(10(15)11(9)16)13(19)18-5-1-2-7(6-18)12(17)20/h3-4,7H,1-2,5-6H2,(H2,17,20) |
| InChIKey | FMUJFVIMVBQRRT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|