C11H12ClF3N2O — CID 119401952
piperazin-1-yl-(2,3,4-trifluorophenyl)methanone;hydrochloride (PubChem CID 119401952) has the molecular formula C11H12ClF3N2O and a molecular weight of 280.68 g/mol. Its IUPAC name is piperazin-1-yl-(2,3,4-trifluorophenyl)methanone;hydrochloride.
| Compound Name | piperazin-1-yl-(2,3,4-trifluorophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119401952 |
| Molecular Formula | C11H12ClF3N2O |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | piperazin-1-yl-(2,3,4-trifluorophenyl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(F)c(F)c1F)N1CCNCC1 |
| InChI | InChI=1S/C11H11F3N2O.ClH/c12-8-2-1-7(9(13)10(8)14)11(17)16-5-3-15-4-6-16;/h1-2,15H,3-6H2;1H |
| InChIKey | QHKAUPGMOXOCOG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|