C18H13ClF4N2O2 — CID 108536978
[4-(2-chloro-6-fluorobenzoyl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 108536978) has the molecular formula C18H13ClF4N2O2 and a molecular weight of 400.76 g/mol. Its IUPAC name is [4-(2-chloro-6-fluorobenzoyl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [4-(2-chloro-6-fluorobenzoyl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 108536978 |
| Molecular Formula | C18H13ClF4N2O2 |
| Molecular Weight | 400.76 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | [4-(2-chloro-6-fluorobenzoyl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1F)N1CCN(C(=O)c2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C18H13ClF4N2O2/c19-11-2-1-3-12(20)14(11)18(27)25-8-6-24(7-9-25)17(26)10-4-5-13(21)16(23)15(10)22/h1-5H,6-9H2 |
| InChIKey | QNEHCOAQTVNRSG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.76 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|