C13H15F3N2O — CID 79014930
(3,3-dimethylpiperazin-1-yl)-(2,3,4-trifluorophenyl)methanone (PubChem CID 79014930) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is (3,3-dimethylpiperazin-1-yl)-(2,3,4-trifluorophenyl)methanone.
| Compound Name | (3,3-dimethylpiperazin-1-yl)-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 79014930 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | (3,3-dimethylpiperazin-1-yl)-(2,3,4-trifluorophenyl)methanone |
| SMILES | CC1(C)CN(C(=O)c2ccc(F)c(F)c2F)CCN1 |
| InChI | InChI=1S/C13H15F3N2O/c1-13(2)7-18(6-5-17-13)12(19)8-3-4-9(14)11(16)10(8)15/h3-4,17H,5-7H2,1-2H3 |
| InChIKey | PZYVEDVDQZETLL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|