C14H14F3NO3 — CID 79757244
3-methyl-1-(2,3,4-trifluorobenzoyl)piperidine-3-carboxylic acid (PubChem CID 79757244) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is 3-methyl-1-(2,3,4-trifluorobenzoyl)piperidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-(2,3,4-trifluorobenzoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 79757244 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-methyl-1-(2,3,4-trifluorobenzoyl)piperidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCN(C(=O)c2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C14H14F3NO3/c1-14(13(20)21)5-2-6-18(7-14)12(19)8-3-4-9(15)11(17)10(8)16/h3-4H,2,5-7H2,1H3,(H,20,21) |
| InChIKey | VFRHLMWMVYLFLR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|