C20H19F3N2O2 — CID 110365762
2-(4-methylphenyl)-1-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]ethanone (PubChem CID 110365762) has the molecular formula C20H19F3N2O2 and a molecular weight of 376.38 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-methylphenyl)-1-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 110365762 |
| Molecular Formula | C20H19F3N2O2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-(4-methylphenyl)-1-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(CC(=O)N2CCN(C(=O)c3ccc(F)c(F)c3F)CC2)cc1 |
| InChI | InChI=1S/C20H19F3N2O2/c1-13-2-4-14(5-3-13)12-17(26)24-8-10-25(11-9-24)20(27)15-6-7-16(21)19(23)18(15)22/h2-7H,8-12H2,1H3 |
| InChIKey | VYIIFPAEOLIPDJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|