C16H17F3N2O4 — CID 110817877
methyl 4-oxo-4-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]butanoate (PubChem CID 110817877) has the molecular formula C16H17F3N2O4 and a molecular weight of 358.32 g/mol. Its IUPAC name is methyl 4-oxo-4-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]butanoate.
| Compound Name | methyl 4-oxo-4-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 110817877 |
| Molecular Formula | C16H17F3N2O4 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | methyl 4-oxo-4-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]butanoate |
| SMILES | COC(=O)CCC(=O)N1CCN(C(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H17F3N2O4/c1-25-13(23)5-4-12(22)20-6-8-21(9-7-20)16(24)10-2-3-11(17)15(19)14(10)18/h2-3H,4-9H2,1H3 |
| InChIKey | FHAIKXBIHLYRME-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|