C21H21F3N2O3 — CID 108535738
2-(2,3-dimethylphenoxy)-1-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]ethanone (PubChem CID 108535738) has the molecular formula C21H21F3N2O3 and a molecular weight of 406.40 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-1-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2,3-dimethylphenoxy)-1-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 108535738 |
| Molecular Formula | C21H21F3N2O3 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-1-[4-(2,3,4-trifluorobenzoyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cccc(OCC(=O)N2CCN(C(=O)c3ccc(F)c(F)c3F)CC2)c1C |
| InChI | InChI=1S/C21H21F3N2O3/c1-13-4-3-5-17(14(13)2)29-12-18(27)25-8-10-26(11-9-25)21(28)15-6-7-16(22)20(24)19(15)23/h3-7H,8-12H2,1-2H3 |
| InChIKey | KARWFBRMYXUONP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|