C16H23N3O3 — CID 37387185
2-[4-[2-(2,3-dimethylphenoxy)acetyl]piperazin-1-yl]acetamide (PubChem CID 37387185) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-[4-[2-(2,3-dimethylphenoxy)acetyl]piperazin-1-yl]acetamide.
| Compound Name | 2-[4-[2-(2,3-dimethylphenoxy)acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 37387185 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2-[4-[2-(2,3-dimethylphenoxy)acetyl]piperazin-1-yl]acetamide |
| SMILES | Cc1cccc(OCC(=O)N2CCN(CC(N)=O)CC2)c1C |
| InChI | InChI=1S/C16H23N3O3/c1-12-4-3-5-14(13(12)2)22-11-16(21)19-8-6-18(7-9-19)10-15(17)20/h3-5H,6-11H2,1-2H3,(H2,17,20) |
| InChIKey | VRRNMPGYCPDJCW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |