C19H28N2O2 — CID 18456277
1-(4-cyclopentylpiperazin-1-yl)-2-(2,3-dimethylphenoxy)ethanone (PubChem CID 18456277) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 1-(4-cyclopentylpiperazin-1-yl)-2-(2,3-dimethylphenoxy)ethanone.
| Compound Name | 1-(4-cyclopentylpiperazin-1-yl)-2-(2,3-dimethylphenoxy)ethanone |
|---|---|
| PubChem CID | 18456277 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 1-(4-cyclopentylpiperazin-1-yl)-2-(2,3-dimethylphenoxy)ethanone |
| SMILES | Cc1cccc(OCC(=O)N2CCN(C3CCCC3)CC2)c1C |
| InChI | InChI=1S/C19H28N2O2/c1-15-6-5-9-18(16(15)2)23-14-19(22)21-12-10-20(11-13-21)17-7-3-4-8-17/h5-6,9,17H,3-4,7-8,10-14H2,1-2H3 |
| InChIKey | GAXXEGJJRCGGDE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |