C18H24N2O4 — CID 42960406
3-[4-[2-(2,3-dimethylphenoxy)acetyl]piperazin-1-yl]oxolan-2-one (PubChem CID 42960406) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-[4-[2-(2,3-dimethylphenoxy)acetyl]piperazin-1-yl]oxolan-2-one.
| Compound Name | 3-[4-[2-(2,3-dimethylphenoxy)acetyl]piperazin-1-yl]oxolan-2-one |
|---|---|
| PubChem CID | 42960406 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 3-[4-[2-(2,3-dimethylphenoxy)acetyl]piperazin-1-yl]oxolan-2-one |
| SMILES | Cc1cccc(OCC(=O)N2CCN(C3CCOC3=O)CC2)c1C |
| InChI | InChI=1S/C18H24N2O4/c1-13-4-3-5-16(14(13)2)24-12-17(21)20-9-7-19(8-10-20)15-6-11-23-18(15)22/h3-5,15H,6-12H2,1-2H3 |
| InChIKey | WXNXUTYAZGKSIQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |