C22H26N2O3S — CID 108546530
2-(2,3-dimethylphenoxy)-1-[4-(2-sulfanylbenzoyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 108546530) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-1-[4-(2-sulfanylbenzoyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-(2,3-dimethylphenoxy)-1-[4-(2-sulfanylbenzoyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 108546530 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-1-[4-(2-sulfanylbenzoyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | Cc1cccc(OCC(=O)N2CCCN(C(=O)c3ccccc3S)CC2)c1C |
| InChI | InChI=1S/C22H26N2O3S/c1-16-7-5-9-19(17(16)2)27-15-21(25)23-11-6-12-24(14-13-23)22(26)18-8-3-4-10-20(18)28/h3-5,7-10,28H,6,11-15H2,1-2H3 |
| InChIKey | PILQIGXZRIUMDI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|