C16H20F3N3O2 — CID 110811670
N-propan-2-yl-4-(2,3,4-trifluorobenzoyl)-1,4-diazepane-1-carboxamide (PubChem CID 110811670) has the molecular formula C16H20F3N3O2 and a molecular weight of 343.35 g/mol. Its IUPAC name is N-propan-2-yl-4-(2,3,4-trifluorobenzoyl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-propan-2-yl-4-(2,3,4-trifluorobenzoyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 110811670 |
| Molecular Formula | C16H20F3N3O2 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-propan-2-yl-4-(2,3,4-trifluorobenzoyl)-1,4-diazepane-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CCCN(C(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H20F3N3O2/c1-10(2)20-16(24)22-7-3-6-21(8-9-22)15(23)11-4-5-12(17)14(19)13(11)18/h4-5,10H,3,6-9H2,1-2H3,(H,20,24) |
| InChIKey | VOTKIWBCWWHEHE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|