C16H21F2N3O2 — CID 110813489
4-(2,5-difluorobenzoyl)-N-propan-2-yl-1,4-diazepane-1-carboxamide (PubChem CID 110813489) has the molecular formula C16H21F2N3O2 and a molecular weight of 325.36 g/mol. Its IUPAC name is 4-(2,5-difluorobenzoyl)-N-propan-2-yl-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(2,5-difluorobenzoyl)-N-propan-2-yl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 110813489 |
| Molecular Formula | C16H21F2N3O2 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 4-(2,5-difluorobenzoyl)-N-propan-2-yl-1,4-diazepane-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CCCN(C(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C16H21F2N3O2/c1-11(2)19-16(23)21-7-3-6-20(8-9-21)15(22)13-10-12(17)4-5-14(13)18/h4-5,10-11H,3,6-9H2,1-2H3,(H,19,23) |
| InChIKey | AONYATILPBLAAT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |