C18H18F2N4O2 — CID 91022778
N-(4-aminophenyl)-4-(2,5-difluorobenzoyl)piperazine-1-carboxamide (PubChem CID 91022778) has the molecular formula C18H18F2N4O2 and a molecular weight of 360.36 g/mol. Its IUPAC name is N-(4-aminophenyl)-4-(2,5-difluorobenzoyl)piperazine-1-carboxamide.
| Compound Name | N-(4-aminophenyl)-4-(2,5-difluorobenzoyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 91022778 |
| Molecular Formula | C18H18F2N4O2 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-(4-aminophenyl)-4-(2,5-difluorobenzoyl)piperazine-1-carboxamide |
| SMILES | Nc1ccc(NC(=O)N2CCN(C(=O)c3cc(F)ccc3F)CC2)cc1 |
| InChI | InChI=1S/C18H18F2N4O2/c19-12-1-6-16(20)15(11-12)17(25)23-7-9-24(10-8-23)18(26)22-14-4-2-13(21)3-5-14/h1-6,11H,7-10,21H2,(H,22,26) |
| InChIKey | XBVHVBMCYDYGHP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|