C12H14F2N2O3S — CID 110804484
(2,5-difluorophenyl)-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 110804484) has the molecular formula C12H14F2N2O3S and a molecular weight of 304.32 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (2,5-difluorophenyl)-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 110804484 |
| Molecular Formula | C12H14F2N2O3S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (2,5-difluorophenyl)-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | CS(=O)(=O)N1CCN(C(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C12H14F2N2O3S/c1-20(18,19)16-6-4-15(5-7-16)12(17)10-8-9(13)2-3-11(10)14/h2-3,8H,4-7H2,1H3 |
| InChIKey | QKLYZRWGXXZYDE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |