C14H20N2O3S — CID 47122985
(2,5-dimethylphenyl)-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 47122985) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is (2,5-dimethylphenyl)-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (2,5-dimethylphenyl)-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 47122985 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (2,5-dimethylphenyl)-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc(C)c(C(=O)N2CCN(S(C)(=O)=O)CC2)c1 |
| InChI | InChI=1S/C14H20N2O3S/c1-11-4-5-12(2)13(10-11)14(17)15-6-8-16(9-7-15)20(3,18)19/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | HYPIXIHONMXRPZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |