C19H28N2O2 — CID 110803941
1-[4-(2,5-dimethylbenzoyl)piperazin-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 110803941) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 1-[4-(2,5-dimethylbenzoyl)piperazin-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[4-(2,5-dimethylbenzoyl)piperazin-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 110803941 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 1-[4-(2,5-dimethylbenzoyl)piperazin-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | Cc1ccc(C)c(C(=O)N2CCN(C(=O)CC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C19H28N2O2/c1-14-6-7-15(2)16(12-14)18(23)21-10-8-20(9-11-21)17(22)13-19(3,4)5/h6-7,12H,8-11,13H2,1-5H3 |
| InChIKey | KJELKRKMICTCEC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |