C18H24Cl2N2O2 — CID 110799323
1-[4-(2,4-dichlorobenzoyl)-1,4-diazepan-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 110799323) has the molecular formula C18H24Cl2N2O2 and a molecular weight of 371.31 g/mol. Its IUPAC name is 1-[4-(2,4-dichlorobenzoyl)-1,4-diazepan-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[4-(2,4-dichlorobenzoyl)-1,4-diazepan-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 110799323 |
| Molecular Formula | C18H24Cl2N2O2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-[4-(2,4-dichlorobenzoyl)-1,4-diazepan-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCCN(C(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C18H24Cl2N2O2/c1-18(2,3)12-16(23)21-7-4-8-22(10-9-21)17(24)14-6-5-13(19)11-15(14)20/h5-6,11H,4,7-10,12H2,1-3H3 |
| InChIKey | YIEYCTAHAMWQRI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |