C17H20Cl2N2O3 — CID 108547420
1-[4-(2,5-dichlorobenzoyl)-1,4-diazepan-1-yl]pentane-1,4-dione (PubChem CID 108547420) has the molecular formula C17H20Cl2N2O3 and a molecular weight of 371.26 g/mol. Its IUPAC name is 1-[4-(2,5-dichlorobenzoyl)-1,4-diazepan-1-yl]pentane-1,4-dione.
| Compound Name | 1-[4-(2,5-dichlorobenzoyl)-1,4-diazepan-1-yl]pentane-1,4-dione |
|---|---|
| PubChem CID | 108547420 |
| Molecular Formula | C17H20Cl2N2O3 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-[4-(2,5-dichlorobenzoyl)-1,4-diazepan-1-yl]pentane-1,4-dione |
| SMILES | CC(=O)CCC(=O)N1CCCN(C(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H20Cl2N2O3/c1-12(22)3-6-16(23)20-7-2-8-21(10-9-20)17(24)14-11-13(18)4-5-15(14)19/h4-5,11H,2-3,6-10H2,1H3 |
| InChIKey | JTVVBUJUAXWOPA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |