C19H18Cl2N2O2S — CID 108547390
[4-(2,5-dichlorobenzoyl)-1,4-diazepan-1-yl]-(2-sulfanylphenyl)methanone (PubChem CID 108547390) has the molecular formula C19H18Cl2N2O2S and a molecular weight of 409.34 g/mol. Its IUPAC name is [4-(2,5-dichlorobenzoyl)-1,4-diazepan-1-yl]-(2-sulfanylphenyl)methanone.
| Compound Name | [4-(2,5-dichlorobenzoyl)-1,4-diazepan-1-yl]-(2-sulfanylphenyl)methanone |
|---|---|
| PubChem CID | 108547390 |
| Molecular Formula | C19H18Cl2N2O2S |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | [4-(2,5-dichlorobenzoyl)-1,4-diazepan-1-yl]-(2-sulfanylphenyl)methanone |
| SMILES | O=C(c1ccccc1S)N1CCCN(C(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C19H18Cl2N2O2S/c20-13-6-7-16(21)15(12-13)19(25)23-9-3-8-22(10-11-23)18(24)14-4-1-2-5-17(14)26/h1-2,4-7,12,26H,3,8-11H2 |
| InChIKey | JSGLYAWPZSPWTQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|