C19H18ClFN2O2 — CID 36615888
[4-(5-chloro-2-fluorobenzoyl)-1,4-diazepan-1-yl]-phenylmethanone (PubChem CID 36615888) has the molecular formula C19H18ClFN2O2 and a molecular weight of 360.82 g/mol. Its IUPAC name is [4-(5-chloro-2-fluorobenzoyl)-1,4-diazepan-1-yl]-phenylmethanone.
| Compound Name | [4-(5-chloro-2-fluorobenzoyl)-1,4-diazepan-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 36615888 |
| Molecular Formula | C19H18ClFN2O2 |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | [4-(5-chloro-2-fluorobenzoyl)-1,4-diazepan-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCCN(C(=O)c2cc(Cl)ccc2F)CC1 |
| InChI | InChI=1S/C19H18ClFN2O2/c20-15-7-8-17(21)16(13-15)19(25)23-10-4-9-22(11-12-23)18(24)14-5-2-1-3-6-14/h1-3,5-8,13H,4,9-12H2 |
| InChIKey | MRRCGQUTFFVVJJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |